ChemNet > CAS > 3278-35-1 diethyl thiodicarbonate
3278-35-1 diethyl thiodicarbonate
| Ürün Adı |
diethyl thiodicarbonate |
| Eş anlamlı |
Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| Moleküler Formülü |
C6H10O3S2 |
| Molekül Ağırlığı |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| CAS kayıt numarası |
3278-35-1 |
| EINECS |
221-911-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.242g/cm3 |
| Kaynama noktası |
236°C at 760 mmHg |
| Kırılma indisi |
1.534 |
| Alevlenme noktası |
96.5°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
