344-14-9 dimethyl fluoromalonate
Ürün Adı |
dimethyl fluoromalonate |
ingilizce adı |
dimethyl fluoromalonate; Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester; Dimethyl 2-Fluoromalonate |
Moleküler Formülü |
C5H7FO4 |
Molekül Ağırlığı |
150.1051 |
InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
CAS kayıt numarası |
344-14-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.211g/cm3 |
Kaynama noktası |
140.3°C at 760 mmHg |
Kırılma indisi |
1.382 |
Alevlenme noktası |
38.4°C |
Buhar basıncı |
6.18mmHg at 25°C |
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|