ChemNet > CAS > 34688-70-5 Pentamethylphenylacetonitrile
34688-70-5 Pentamethylphenylacetonitrile
Ürün Adı |
Pentamethylphenylacetonitrile |
ingilizce adı |
Pentamethylphenylacetonitrile; 2,3,4,5,6-Pentamethylbenzyl cyanide |
Moleküler Formülü |
C13H17N |
Molekül Ağırlığı |
187.2808 |
InChI |
InChI=1/C13H17N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6H2,1-5H3 |
CAS kayıt numarası |
34688-70-5 |
Moleküler Yapısı |
|
Yoğunluk |
0.95g/cm3 |
Ergime noktası |
105-107℃ |
Kaynama noktası |
325.9°C at 760 mmHg |
Kırılma indisi |
1.519 |
Alevlenme noktası |
160.2°C |
Buhar basıncı |
0.000224mmHg at 25°C |
Risk Kodları |
R20/22:Harmful by inhalation and if swallowed.;
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|