ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
Ürün Adı |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
Eş anlamlı |
1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
Moleküler Formülü |
C14H17NO |
Molekül Ağırlığı |
215.2909 |
InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
CAS kayıt numarası |
36263-51-1 |
EINECS |
252-938-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.06g/cm3 |
Ergime noktası |
40-45℃ |
Kaynama noktası |
362°C at 760 mmHg |
Kırılma indisi |
1.538 |
Alevlenme noktası |
152.6°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|