ChemNet > CAS > 37107-50-9 Cyclohexylidenecyanoacetic acid
37107-50-9 Cyclohexylidenecyanoacetic acid
| Ürün Adı |
Cyclohexylidenecyanoacetic acid |
| Eş anlamlı |
Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
| Moleküler Formülü |
C9H11NO2 |
| Molekül Ağırlığı |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
| CAS kayıt numarası |
37107-50-9 |
| EINECS |
253-351-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.211g/cm3 |
| Kaynama noktası |
353.9°C at 760 mmHg |
| Kırılma indisi |
1.537 |
| Alevlenme noktası |
167.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
