ChemNet > CAS > 37107-50-9 Cyclohexylidenecyanoacetic acid
37107-50-9 Cyclohexylidenecyanoacetic acid
Ürün Adı |
Cyclohexylidenecyanoacetic acid |
Eş anlamlı |
Cyanocyclohexylideneacetic acid; 2-Cyano-2-cyclohexylidene-acetic acid |
Moleküler Formülü |
C9H11NO2 |
Molekül Ağırlığı |
165.1891 |
InChI |
InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
CAS kayıt numarası |
37107-50-9 |
EINECS |
253-351-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.211g/cm3 |
Kaynama noktası |
353.9°C at 760 mmHg |
Kırılma indisi |
1.537 |
Alevlenme noktası |
167.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|