ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
| Ürün Adı |
4-Fluoro-3-formylbenzeneboronic acid |
| Eş anlamlı |
5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
| Moleküler Formülü |
C7H6BFO3 |
| Molekül Ağırlığı |
167.9301 |
| InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
| CAS kayıt numarası |
374538-01-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.33g/cm3 |
| Kaynama noktası |
342.9°C at 760 mmHg |
| Kırılma indisi |
1.524 |
| Alevlenme noktası |
161.2°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
