ChemNet > CAS > 374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
374538-01-9 4-Fluoro-3-formylbenzeneboronic acid
Ürün Adı |
4-Fluoro-3-formylbenzeneboronic acid |
Eş anlamlı |
5-Borono-2-fluorobenzaldehyde; 4-Fluoro-3-formylphenylboronic acid; (4-fluoro-3-formylphenyl)boronic acid |
Moleküler Formülü |
C7H6BFO3 |
Molekül Ağırlığı |
167.9301 |
InChI |
InChI=1/C7H6BFO3/c9-7-2-1-6(8(11)12)3-5(7)4-10/h1-4,11-12H |
CAS kayıt numarası |
374538-01-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.33g/cm3 |
Kaynama noktası |
342.9°C at 760 mmHg |
Kırılma indisi |
1.524 |
Alevlenme noktası |
161.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|