ChemNet > CAS > 37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
37619-24-2 Methyl 1-methylpyrrole-2-carboxylate
Ürün Adı |
Methyl 1-methylpyrrole-2-carboxylate |
Eş anlamlı |
1-Methylpyrrole-2-carboxylic acid methyl ester; methyl 1-methyl-1H-pyrrole-2-carboxylate |
Moleküler Formülü |
C7H9NO2 |
Molekül Ağırlığı |
139.1519 |
InChI |
InChI=1/C7H9NO2/c1-8-5-3-4-6(8)7(9)10-2/h3-5H,1-2H3 |
CAS kayıt numarası |
37619-24-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.07g/cm3 |
Kaynama noktası |
204.7°C at 760 mmHg |
Kırılma indisi |
1.5 |
Alevlenme noktası |
77.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|