ChemNet > CAS > 39620-02-5 5-Bromonicotinoyl chloride
39620-02-5 5-Bromonicotinoyl chloride
Ürün Adı |
5-Bromonicotinoyl chloride |
Eş anlamlı |
5-Bromopyridine-3-carbonyl chloride |
Moleküler Formülü |
C6H3BrClNO |
Molekül Ağırlığı |
220.4511 |
InChI |
InChI=1/C6H3BrClNO/c7-5-1-4(6(8)10)2-9-3-5/h1-3H |
CAS kayıt numarası |
39620-02-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.76g/cm3 |
Ergime noktası |
75℃ |
Kaynama noktası |
265.4°C at 760 mmHg |
Kırılma indisi |
1.59 |
Alevlenme noktası |
114.3°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|