ChemNet > CAS > 4079-52-1 2-Methoxyacetophenone
4079-52-1 2-Methoxyacetophenone
Ürün Adı |
2-Methoxyacetophenone |
Eş anlamlı |
2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
Moleküler Formülü |
C9H10O2 |
Molekül Ağırlığı |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
CAS kayıt numarası |
4079-52-1 |
EINECS |
223-802-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.035g/cm3 |
Ergime noktası |
7-8℃ |
Kaynama noktası |
245°C at 760 mmHg |
Kırılma indisi |
1.504 |
Alevlenme noktası |
92.8°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|