ChemNet > CAS > 40803-53-0 5-Bromo-2-methoxycinnamic acid
40803-53-0 5-Bromo-2-methoxycinnamic acid
Ürün Adı |
5-Bromo-2-methoxycinnamic acid |
Eş anlamlı |
(2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoic acid; (2E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
Moleküler Formülü |
C10H8BrO3 |
Molekül Ağırlığı |
256.0733 |
InChI |
InChI=1/C10H9BrO3/c1-14-9-4-3-8(11)6-7(9)2-5-10(12)13/h2-6H,1H3,(H,12,13)/p-1/b5-2+ |
CAS kayıt numarası |
40803-53-0 |
Moleküler Yapısı |
|
Ergime noktası |
224-227℃ |
Kaynama noktası |
381.5°C at 760 mmHg |
Alevlenme noktası |
184.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|