ChemNet > CAS > 4476-28-2 4-Isopropylphenylacetic acid
4476-28-2 4-Isopropylphenylacetic acid
Ürün Adı |
4-Isopropylphenylacetic acid |
Eş anlamlı |
AI3-12008; Benzeneacetic acid, 4-(1-methylethyl)-; [4-(propan-2-yl)phenyl]acetic acid; [4-(1-methylethyl)phenyl]acetate |
Moleküler Formülü |
C11H13O2 |
Molekül Ağırlığı |
177.2203 |
InChI |
InChI=1/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)/p-1 |
CAS kayıt numarası |
4476-28-2 |
EINECS |
224-755-2 |
Moleküler Yapısı |
|
Kaynama noktası |
295°C at 760 mmHg |
Alevlenme noktası |
192.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|