ChemNet > CAS > 52727-57-8 Methyl 2-amino-5-bromobenzoate
52727-57-8 Methyl 2-amino-5-bromobenzoate
Ürün Adı |
Methyl 2-amino-5-bromobenzoate |
Eş anlamlı |
2-Amino-5-bromobenzoic acid methyl ester; 5-Bromoanthranilic acid methyl ester |
Moleküler Formülü |
C8H8BrNO2 |
Molekül Ağırlığı |
230.0586 |
InChI |
InChI=1/C8H8BrNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
CAS kayıt numarası |
52727-57-8 |
Moleküler Yapısı |
|
Yoğunluk |
1.578g/cm3 |
Ergime noktası |
72-74℃ |
Kaynama noktası |
286.3°C at 760 mmHg |
Kırılma indisi |
1.601 |
Alevlenme noktası |
126.9°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|