ChemNet > CAS > 52727-57-8 Methyl 2-amino-5-bromobenzoate
52727-57-8 Methyl 2-amino-5-bromobenzoate
| Ürün Adı |
Methyl 2-amino-5-bromobenzoate |
| Eş anlamlı |
2-Amino-5-bromobenzoic acid methyl ester; 5-Bromoanthranilic acid methyl ester |
| Moleküler Formülü |
C8H8BrNO2 |
| Molekül Ağırlığı |
230.0586 |
| InChI |
InChI=1/C8H8BrNO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,10H2,1H3 |
| CAS kayıt numarası |
52727-57-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.578g/cm3 |
| Ergime noktası |
72-74℃ |
| Kaynama noktası |
286.3°C at 760 mmHg |
| Kırılma indisi |
1.601 |
| Alevlenme noktası |
126.9°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
