ChemNet > CAS > 53001-71-1 2,3,4,5-Tetrafluorobenzyl bromide
53001-71-1 2,3,4,5-Tetrafluorobenzyl bromide
| Ürün Adı |
2,3,4,5-Tetrafluorobenzyl bromide |
| Eş anlamlı |
alpha-Bromo-2,3,4,5-tetrafluorotoluene; 1-(bromomethyl)-2,3,4,5-tetrafluorobenzene |
| Moleküler Formülü |
C7H3BrF4 |
| Molekül Ağırlığı |
242.9963 |
| InChI |
InChI=1/C7H3BrF4/c8-2-3-1-4(9)6(11)7(12)5(3)10/h1H,2H2 |
| CAS kayıt numarası |
53001-71-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.789g/cm3 |
| Kaynama noktası |
183.8°C at 760 mmHg |
| Kırılma indisi |
1.484 |
| Alevlenme noktası |
84.2°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
