ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
Ürün Adı |
3-Ethoxy-2-cyclohexen-1-one |
Eş anlamlı |
3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
Moleküler Formülü |
C8H12O2 |
Molekül Ağırlığı |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
CAS kayıt numarası |
5323-87-5 |
EINECS |
226-190-7 |
Moleküler Yapısı |
|
Yoğunluk |
1g/cm3 |
Kaynama noktası |
250.1°C at 760 mmHg |
Kırılma indisi |
1.467 |
Alevlenme noktası |
107.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|