ChemNet > CAS > 5446-58-2 N-p-Toluenesulfonylimino-3,3'-dipropionic acid
5446-58-2 N-p-Toluenesulfonylimino-3,3'-dipropionic acid
| Ürün Adı |
N-p-Toluenesulfonylimino-3,3'-dipropionic acid |
| Eş anlamlı |
N-p-Toluenesulphonylimino-3,3-dipropionic acid; 3,3'-{[(4-methylphenyl)sulfonyl]imino}dipropanoic acid (non-preferred name); N-(2,4-dimethylphenyl)-2-morpholin-4-yl-2-thioxoacetamide |
| Moleküler Formülü |
C14H18N2O2S |
| Molekül Ağırlığı |
278.3699 |
| InChI |
InChI=1/C14H18N2O2S/c1-10-3-4-12(11(2)9-10)15-13(17)14(19)16-5-7-18-8-6-16/h3-4,9H,5-8H2,1-2H3,(H,15,17) |
| CAS kayıt numarası |
5446-58-2 |
| EINECS |
226-660-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.258g/cm3 |
| Ergime noktası |
170-173℃ |
| Kırılma indisi |
1.632 |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
