ChemNet > CAS > 54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
54679-16-2 4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole
| Ürün Adı |
4-(chloromethyl)-2-(2-thienyl)-1,3-thiazole |
| Eş anlamlı |
4-(chloromethyl)-2-(thiophen-2-yl)-1,3-thiazole |
| Moleküler Formülü |
C8H6ClNS2 |
| Molekül Ağırlığı |
215.7229 |
| InChI |
InChI=1/C8H6ClNS2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4H2 |
| CAS kayıt numarası |
54679-16-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.395g/cm3 |
| Ergime noktası |
51℃ |
| Kaynama noktası |
362°C at 760 mmHg |
| Kırılma indisi |
1.636 |
| Alevlenme noktası |
172.7°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
