ChemNet > CAS > 58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
Ürün Adı |
1-(5-nitro-3-thienyl)ethan-1-one |
Eş anlamlı |
4-Acetyl-2-nitrothiophene; 1-(5-nitrothiophen-3-yl)ethanone |
Moleküler Formülü |
C6H5NO3S |
Molekül Ağırlığı |
171.1738 |
InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-6(7(9)10)11-3-5/h2-3H,1H3 |
CAS kayıt numarası |
58157-89-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.399g/cm3 |
Ergime noktası |
59℃ |
Kaynama noktası |
247.9°C at 760 mmHg |
Kırılma indisi |
1.589 |
Alevlenme noktası |
103.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|