ChemNet > CAS > 60404-18-4 3-Bromo-2,5-dichlorothiophene
60404-18-4 3-Bromo-2,5-dichlorothiophene
| Ürün Adı |
3-Bromo-2,5-dichlorothiophene |
| Moleküler Formülü |
C4HBrCl2S |
| Molekül Ağırlığı |
231.9257 |
| InChI |
InChI=1/C4HBrCl2S/c5-2-1-3(6)8-4(2)7/h1H |
| CAS kayıt numarası |
60404-18-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.949g/cm3 |
| Kaynama noktası |
223.1°C at 760 mmHg |
| Kırılma indisi |
1.625 |
| Alevlenme noktası |
88.7°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
