ChemNet > CAS > 621-54-5 3-(3-Hydroxyphenyl)propionic acid
621-54-5 3-(3-Hydroxyphenyl)propionic acid
| Ürün Adı |
3-(3-Hydroxyphenyl)propionic acid |
| Eş anlamlı |
3-Hydroxyhydrocinnamic acid; 3-Hydroxyphenyl-propionic acid; 3-(3-hydroxyphenyl)propanoic acid |
| Moleküler Formülü |
C9H10O3 |
| Molekül Ağırlığı |
166.1739 |
| InChI |
InChI=1/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12) |
| CAS kayıt numarası |
621-54-5 |
| EINECS |
210-692-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.26g/cm3 |
| Kaynama noktası |
354.5°C at 760 mmHg |
| Kırılma indisi |
1.58 |
| Alevlenme noktası |
182.4°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
