ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
| Ürün Adı |
2-Nitroethanol |
| Eş anlamlı |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| Moleküler Formülü |
C2H5NO3 |
| Molekül Ağırlığı |
91.07 |
| InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| CAS kayıt numarası |
625-48-9 |
| EINECS |
210-895-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.267g/cm3 |
| Kaynama noktası |
193.8°C at 760 mmHg |
| Kırılma indisi |
1.438 |
| Alevlenme noktası |
113.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
