ChemNet > CAS > 63139-21-9 4-Ethylphenylboronic acid
63139-21-9 4-Ethylphenylboronic acid
| Ürün Adı |
4-Ethylphenylboronic acid |
| Eş anlamlı |
4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
| Moleküler Formülü |
C8H11BO2 |
| Molekül Ağırlığı |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| CAS kayıt numarası |
63139-21-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.07g/cm3 |
| Ergime noktası |
150-155℃ |
| Kaynama noktası |
285.1°C at 760 mmHg |
| Kırılma indisi |
1.521 |
| Alevlenme noktası |
126.2°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
