ChemNet > CAS > 63139-21-9 4-Ethylphenylboronic acid
63139-21-9 4-Ethylphenylboronic acid
Ürün Adı |
4-Ethylphenylboronic acid |
Eş anlamlı |
4-Ethylbenzeneboronic acid; P-Ethylphenylboronic acid; 4-Ethylphenyl boronic acid |
Moleküler Formülü |
C8H11BO2 |
Molekül Ağırlığı |
149.9827 |
InChI |
InChI=1/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
CAS kayıt numarası |
63139-21-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.07g/cm3 |
Ergime noktası |
150-155℃ |
Kaynama noktası |
285.1°C at 760 mmHg |
Kırılma indisi |
1.521 |
Alevlenme noktası |
126.2°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|