ChemNet > CAS > 63155-04-4 4-chloro-5-methylbenzene-1,2-diamine
63155-04-4 4-chloro-5-methylbenzene-1,2-diamine
| Ürün Adı |
4-chloro-5-methylbenzene-1,2-diamine |
| Eş anlamlı |
1,2-Diamino-4-chloro-5-methylbenzene |
| Moleküler Formülü |
C7H9ClN2 |
| Molekül Ağırlığı |
156.6128 |
| InChI |
InChI=1/C7H9ClN2/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,9-10H2,1H3 |
| CAS kayıt numarası |
63155-04-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.281g/cm3 |
| Ergime noktası |
138℃ |
| Kaynama noktası |
307°C at 760 mmHg |
| Kırılma indisi |
1.647 |
| Alevlenme noktası |
139.4°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
