ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
| Ürün Adı |
1-(2,6-Dimethylphenyl)-thiourea |
| Eş anlamlı |
2,6-Dimethylphenylthiourea |
| Moleküler Formülü |
C9H12N2S |
| Molekül Ağırlığı |
180.27 |
| InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| CAS kayıt numarası |
6396-76-5 |
| EINECS |
229-005-8 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.2g/cm3 |
| Kaynama noktası |
284.4°C at 760 mmHg |
| Kırılma indisi |
1.674 |
| Alevlenme noktası |
125.8°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R25:Toxic if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
