ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
Ürün Adı |
2-Chloro-6-methylbenzonitrile |
Eş anlamlı |
6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
Moleküler Formülü |
C8H6ClN |
Molekül Ağırlığı |
151.5929 |
InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
CAS kayıt numarası |
6575-09-3 |
EINECS |
229-499-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.19g/cm3 |
Ergime noktası |
78-83℃ |
Kaynama noktası |
241.1°C at 760 mmHg |
Kırılma indisi |
1.553 |
Alevlenme noktası |
110.1°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|