ChemNet > CAS > 6575-09-3 2-Chloro-6-methylbenzonitrile
6575-09-3 2-Chloro-6-methylbenzonitrile
| Ürün Adı |
2-Chloro-6-methylbenzonitrile |
| Eş anlamlı |
6-Chloro-o-tolunitrile; 3-chloro-2-toluonitrile |
| Moleküler Formülü |
C8H6ClN |
| Molekül Ağırlığı |
151.5929 |
| InChI |
InChI=1/C8H6ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,1H3 |
| CAS kayıt numarası |
6575-09-3 |
| EINECS |
229-499-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.19g/cm3 |
| Ergime noktası |
78-83℃ |
| Kaynama noktası |
241.1°C at 760 mmHg |
| Kırılma indisi |
1.553 |
| Alevlenme noktası |
110.1°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|
