ChemNet > CAS > 7151-68-0 3-Methoxy-4-methylbenzoic acid
7151-68-0 3-Methoxy-4-methylbenzoic acid
Ürün Adı |
3-Methoxy-4-methylbenzoic acid |
Eş anlamlı |
4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid~4-Methyl-m-anisic acid; 3-Methoxy-p-toluic acid (COOH=1); 3-methoxy-4-methylbenzoate |
Moleküler Formülü |
C9H9O3 |
Molekül Ağırlığı |
165.1665 |
InChI |
InChI=1/C9H10O3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5H,1-2H3,(H,10,11)/p-1 |
CAS kayıt numarası |
7151-68-0 |
EINECS |
230-486-1 |
Moleküler Yapısı |
|
Ergime noktası |
152-154℃ |
Kaynama noktası |
309.9°C at 760 mmHg |
Alevlenme noktası |
126.2°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S24/25:;
|
|