ChemNet > CAS > 719-60-8 Pentafluorocinnamic acid
719-60-8 Pentafluorocinnamic acid
Ürün Adı |
Pentafluorocinnamic acid |
Eş anlamlı |
2,3,4,5,6-Pentafluorocinnamic acid; (2E)-3-(pentafluorophenyl)prop-2-enoate; (2E)-3-(pentafluorophenyl)prop-2-enoic acid; 3-(pentafluorophenyl)prop-2-enoate |
Moleküler Formülü |
C9H2F5O2 |
Molekül Ağırlığı |
237.1035 |
InChI |
InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
CAS kayıt numarası |
719-60-8 |
Moleküler Yapısı |
|
Ergime noktası |
152-156℃ |
Kaynama noktası |
251.5°C at 760 mmHg |
Alevlenme noktası |
105.9°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|