ChemNet > CAS > 723-89-7 1-phenylisatin
723-89-7 1-phenylisatin
Ürün Adı |
1-phenylisatin |
Eş anlamlı |
1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
Moleküler Formülü |
C14H9NO2 |
Molekül Ağırlığı |
223.2268 |
InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
CAS kayıt numarası |
723-89-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.338g/cm3 |
Ergime noktası |
138-140℃ |
Kaynama noktası |
388.8°C at 760 mmHg |
Kırılma indisi |
1.667 |
Alevlenme noktası |
182.6°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|