729-43-1 Acetophenone Azine
| Ürün Adı |
Acetophenone Azine |
| ingilizce adı |
Acetophenone Azine;Ethanone, 1-phenyl-, 2-(1-phenylethylidene)hydrazone; Acetophenone azine; Ethanone, 1-phenyl-, (1-phenylethylidene)hydrazone; NSC 25772; 1-Phenylethan-1-one (1-phenylethylidene)hydrazone; Acetophenone, azine (8CI); bis(1-phenylethylidene)hydrazine; (1Z,2Z)-bis(1-phenylethylidene)hydrazine; (1E,2E)-bis(1-phenylethylidene)hydrazine |
| Moleküler Formülü |
C16H16N2 |
| Molekül Ağırlığı |
236.3116 |
| InChI |
InChI=1/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ |
| CAS kayıt numarası |
729-43-1 |
| EINECS |
211-979-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.98g/cm3 |
| Kaynama noktası |
333.2°C at 760 mmHg |
| Kırılma indisi |
1.551 |
| Alevlenme noktası |
147.4°C |
| Buhar basıncı |
0.000268mmHg at 25°C |
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|