CAS No: 74472-49-4, Chemical Name: 2,2',3,4,5,6,6'-heptachlorobiphenyl
the physical and chemical property of 74472-49-4, 2,2',3,4,5,6,6'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 74472-49-4 2,2',3,4,5,6,6'-heptachlorobiphenyl
74472-49-4 2,2',3,4,5,6,6'-heptachlorobiphenyl
| Ürün Adı |
2,2',3,4,5,6,6'-heptachlorobiphenyl |
| Eş anlamlı |
1,1'-biphenyl, 2,2',3,4,5,6,6'-heptachloro-; 2,2',3,4,5,6,6'-Heptachloro-1,1'-biphenyl; 2,2',3,4,5,6,6'-PCB; 74472-49-4 |
| Moleküler Formülü |
C12H3Cl7 |
| Molekül Ağırlığı |
395.3232 |
| InChI |
InChI=1/C12H3Cl7/c13-4-2-1-3-5(14)6(4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
| CAS kayıt numarası |
74472-49-4 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.658g/cm3 |
| Kaynama noktası |
395.2°C at 760 mmHg |
| Kırılma indisi |
1.632 |
| Alevlenme noktası |
189.3°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
|
|
