ChemNet > CAS > 75-39-8 Acetaldehyde ammonia trimer
75-39-8 Acetaldehyde ammonia trimer
Ürün Adı |
Acetaldehyde ammonia trimer |
Eş anlamlı |
Hexahydro-2,4,6-trimethyl-s-triazine trihydrate; Acetaldehyde ammonia trimer,; Acetaldehyde-Ammonia; 1-aminoethanol; acetaldehyde ammoniate (1:1) |
Moleküler Formülü |
C2H7NO |
Molekül Ağırlığı |
61.0831 |
InChI |
InChI=1/C2H7NO/c1-2(3)4/h2,4H,3H2,1H3 |
CAS kayıt numarası |
75-39-8 |
EINECS |
200-868-2 |
Moleküler Yapısı |
|
Yoğunluk |
0.967g/cm3 |
Ergime noktası |
95-97℃ |
Kaynama noktası |
113.8°C at 760 mmHg |
Kırılma indisi |
1.431 |
Alevlenme noktası |
22.7°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|