ChemNet > CAS > 76058-33-8 Ethyl Red
76058-33-8 Ethyl Red
| Ürün Adı |
Ethyl Red |
| Eş anlamlı |
2-[4-(Diethylamino)phenylazo]benzoic acid; 2-(4-Diethylaminophenylazo)benzoic acid; Diethyl red; 2-{(E)-[4-(diethylamino)phenyl]diazenyl}benzoate |
| Moleküler Formülü |
C17H18N3O2 |
| Molekül Ağırlığı |
296.3443 |
| InChI |
InChI=1/C17H19N3O2/c1-3-20(4-2)14-11-9-13(10-12-14)18-19-16-8-6-5-7-15(16)17(21)22/h5-12H,3-4H2,1-2H3,(H,21,22)/p-1/b19-18+ |
| CAS kayıt numarası |
76058-33-8 |
| Moleküler Yapısı |
|
| Ergime noktası |
135℃ |
| Kaynama noktası |
496.9°C at 760 mmHg |
| Alevlenme noktası |
254.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R20/21:Harmful by inhalation and in contact with skin.;
R32:Contact with acids liberates very toxic gas.;
|
| Güvenlik Açıklaması |
|
|
