ChemNet > CAS > 81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
81074-81-9 5-(dimethylaminomethyl)furfuryl alcohol hydrochlo
| Ürün Adı |
5-(dimethylaminomethyl)furfuryl alcohol hydrochlo |
| Eş anlamlı |
5-(Dimethylaminomethyl)furfuryl alcohol hydrochloride; {5-[(dimethylamino)methyl]furan-2-yl}methanol hydrochloride |
| Moleküler Formülü |
C8H14ClNO2 |
| Molekül Ağırlığı |
191.6553 |
| InChI |
InChI=1/C8H13NO2.ClH/c1-9(2)5-7-3-4-8(6-10)11-7;/h3-4,10H,5-6H2,1-2H3;1H |
| CAS kayıt numarası |
81074-81-9 |
| EINECS |
279-686-0 |
| Moleküler Yapısı |
|
| Ergime noktası |
122-125℃ |
| Kaynama noktası |
217.7°C at 760 mmHg |
| Alevlenme noktası |
85.5°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
