ChemNet > CAS > 84540-59-0 4-Methyl-3-nitrobenzyl chloride
84540-59-0 4-Methyl-3-nitrobenzyl chloride
Ürün Adı |
4-Methyl-3-nitrobenzyl chloride |
Eş anlamlı |
4-(Chloromethyl)-2-nitrotoluene; 4-(chloromethyl)-1-methyl-2-nitrobenzene |
Moleküler Formülü |
C8H8ClNO2 |
Molekül Ağırlığı |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-7(5-9)4-8(6)10(11)12/h2-4H,5H2,1H3 |
CAS kayıt numarası |
84540-59-0 |
EINECS |
283-154-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.277g/cm3 |
Ergime noktası |
46-50℃ |
Kaynama noktası |
336.5°C at 760 mmHg |
Kırılma indisi |
1.566 |
Alevlenme noktası |
133.3°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|