ChemNet > CAS > 85684-64-6 2-(difluoromethoxy)benzyl bromide
85684-64-6 2-(difluoromethoxy)benzyl bromide
| Ürün Adı |
2-(difluoromethoxy)benzyl bromide |
| Eş anlamlı |
alpha-Bromo-2-difluoromethoxytoluene; 1-(bromomethyl)-2-(difluoromethoxy)benzene |
| Moleküler Formülü |
C8H7BrF2O |
| Molekül Ağırlığı |
237.0414 |
| InChI |
InChI=1/C8H7BrF2O/c9-5-6-3-1-2-4-7(6)12-8(10)11/h1-4,8H,5H2 |
| CAS kayıt numarası |
85684-64-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.537g/cm3 |
| Kaynama noktası |
225.2°C at 760 mmHg |
| Kırılma indisi |
1.506 |
| Alevlenme noktası |
108.9°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R34:Causes burns.;
R36:Irritating to eyes.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
