ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
| Ürün Adı |
2-Methoxybiphenyl |
| Eş anlamlı |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
| Moleküler Formülü |
C13H12O |
| Molekül Ağırlığı |
184.2338 |
| InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
| CAS kayıt numarası |
86-26-0 |
| EINECS |
201-659-9 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.03g/cm3 |
| Ergime noktası |
30-33℃ |
| Kaynama noktası |
274°C at 760 mmHg |
| Kırılma indisi |
1.556 |
| Alevlenme noktası |
101.3°C |
| Tehlike Sembolleri |
 Xn:Harmful;
|
| Risk Kodları |
R33:Danger of cummulative effects.;
|
| Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
