ChemNet > CAS > 86-26-0 2-Methoxybiphenyl
86-26-0 2-Methoxybiphenyl
Ürün Adı |
2-Methoxybiphenyl |
Eş anlamlı |
2-Phenylanisole; biphenyl-2-yl methyl ether; o-Methoxybiphenyl |
Moleküler Formülü |
C13H12O |
Molekül Ağırlığı |
184.2338 |
InChI |
InChI=1/C13H12O/c1-14-13-10-6-5-9-12(13)11-7-3-2-4-8-11/h2-10H,1H3 |
CAS kayıt numarası |
86-26-0 |
EINECS |
201-659-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.03g/cm3 |
Ergime noktası |
30-33℃ |
Kaynama noktası |
274°C at 760 mmHg |
Kırılma indisi |
1.556 |
Alevlenme noktası |
101.3°C |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R33:Danger of cummulative effects.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|