ChemNet > CAS > 86508-29-4 1- (4-klorofenil) -2- (4-metilfenil) etan-1,2-dion
86508-29-4 1- (4-klorofenil) -2- (4-metilfenil) etan-1,2-dion
Ürün Adı |
1- (4-klorofenil) -2- (4-metilfenil) etan-1,2-dion |
Eş anlamlı |
|
ingilizce adı |
1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione; |
Moleküler Formülü |
C15H11ClO2 |
Molekül Ağırlığı |
258.6996 |
InChI |
InChI=1/C15H11ClO2/c1-10-2-4-11(5-3-10)14(17)15(18)12-6-8-13(16)9-7-12/h2-9H,1H3 |
CAS kayıt numarası |
86508-29-4 |
Moleküler Yapısı |
|
Yoğunluk |
1.24g/cm3 |
Ergime noktası |
108℃ |
Kaynama noktası |
413.2°C at 760 mmHg |
Kırılma indisi |
1.595 |
Alevlenme noktası |
174.5°C |
Buhar basıncı |
4.9E-07mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|