ChemNet > CAS > 90580-64-6 4-Borono-DL-phenylalanine
90580-64-6 4-Borono-DL-phenylalanine
Ürün Adı |
4-Borono-DL-phenylalanine |
Eş anlamlı |
2-Amino-3-[4-(dihydroxyboryl)phenyl]propanoic acid |
Moleküler Formülü |
C9H12BNO4 |
Molekül Ağırlığı |
209.00
|
InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m0/s1 |
CAS kayıt numarası |
90580-64-6 |
Moleküler Yapısı |
|
Ergime noktası |
270℃ |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|