ChemNet > CAS > 933-76-6 4,5-Dichloro-2-methylpyridazin-3-one
933-76-6 4,5-Dichloro-2-methylpyridazin-3-one
| Ürün Adı |
4,5-Dichloro-2-methylpyridazin-3-one |
| Eş anlamlı |
3(2H)-Pyridazinone, 4,5-dichloro-2-methyl-; 4,5-Dichloro-2-methyl-3(2H)-pyridazinone; 5-24-02-00023 (Beilstein Handbook Reference); BRN 0127609; 4,5-dichloro-2-methylpyridazin-3(2H)-one |
| Moleküler Formülü |
C5H4Cl2N2O |
| Molekül Ağırlığı |
179.0041 |
| InChI |
InChI=1/C5H4Cl2N2O/c1-9-5(10)4(7)3(6)2-8-9/h2H,1H3 |
| CAS kayıt numarası |
933-76-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.55g/cm3 |
| Kaynama noktası |
197.2°C at 760 mmHg |
| Kırılma indisi |
1.611 |
| Alevlenme noktası |
73.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
