942-92-7 Hexanophenone
Ürün Adı |
Hexanophenone |
ingilizce adı |
Hexanophenone; n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
Moleküler Formülü |
C12H16O |
Molekül Ağırlığı |
176.2548 |
InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
CAS kayıt numarası |
942-92-7 |
EINECS |
213-394-6 |
Moleküler Yapısı |
|
Yoğunluk |
0.942g/cm3 |
Ergime noktası |
25-26℃ |
Kaynama noktası |
265°C at 760 mmHg |
Kırılma indisi |
1.498 |
Alevlenme noktası |
105.5°C |
Buhar basıncı |
0.0094mmHg at 25°C |
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|