Details for 2-ethylanthraquinone

2-ethylanthraquinone
| Category: |
Intermediates |
|
| CAS NO: |
84-51-5 |
| EC NO: |
201-535-4 |
| Molecular Formula: |
C16H12O2 |
| Molecular Weight: |
236.2653 |
| Specification: |
98.5% min |
| InChI: |
InChI=1/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
| Packing: |
25kg/bag |
| Uses: |
solvent |
| Synonyms: |
Ethylanthraquinone;2-Ethyl Anthraquinone;2-ethylanthracene-9,10-dione;Photoinitiator-2-EAQ; |
| Molecular Structure: |
 |
if you are sourcing 2-ethylanthraquinone from China ,just feel free to inquire