China Albendazole Suppliers, China Albendazole Manufacturers.

ChemNet  |   Sign in  |   Join Now
Verified
Supplier
13th

year

Jiangsu Quality Horizons Pharmtech Co., Ltd.
http://www.chemnet.com/ChinaSuppliers/15971/
CN China Suppliers > yabang-qhpharm >

Albendazole

Details for Albendazole

Albendazole

Category:

Intermediates

Albendazole
CAS NO: 54965-21-8
EC NO: 259-414-7
Molecular Formula: C12H15N3O2S
Molecular Weight: 265.3314
Specification:
InChI: InChI=1/C12H15N3O2S/c1-3-6-18-8-4-5-9-10(7-8)14-11(13-9)15-12(16)17-2/h4-5,7H,3,6H2,1-2H3,(H2,13,14,15,16)
Product description:
Substance Name Albendazole
Synonyms
* Albendazolum [INN-Latin],
* ((Propylthio)-5 1H-benzimidazolyl-2) carbamate de methyle [French],
* (5-(Propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester,
* 1503903, * 220008, * 5-(Propylthio)-2-carbomethoxyaminobenzimidazole,
* AIDS-007895, * AIDS007895, * Albendazol [INN-Spanish],
* Albendazole (JAN/USP), * Albendazole [USAN:BAN:INN:JAN],
* Albenza, * Albenza (TN), * Bilutac, * C01779,
* Carbamic acid, [5- (propylthio)-1H-benzimidazol-2-yl]-, methyl ester,
* Carbamic acid, [5-(propylthio)-1H-benzimidazol-2-yl]-, methyl ester,
* CHEMBANK1308, * DRG-0277, * EINECS 259-414-7, * Eskazole,
* Methyl 5-(propylsulfanyl)-1H-benzimidazol-2-ylcarbamate,
* Methyl 5-(propylthio)-2-benzimidazolecarbamate, * MLS000069722,
* NSC 220008, * NSC220008,
* O-Methyl N-(5-(propylthio)-2-benzimidazolyl)carbamate,
* Proftril, * SK&F 62979, * SKandF 62979, * SKF 62979, * SKF-62979,
* SMR000036735, * Valbazen, * Zental, * Zentel,
* ZINC01821118, * ZINC01821119,
* [5-(Propythio)-1H-benzimidazol-2-yl]carbamic acid methyl ester,
Chemical Name (5-(Propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester
Molecular Formula C12H15N3O2S
Molecular Weight 265.3294
CAS No. 54965-21-8
Chemical Structure
Specification EP/USP/CP
Pharmacodynamic
Properties
Albendazole is a broad-spectrum anthelmintic for humans and animals. It works by interfering with proteins in either the worm抯 intestine or absorptive cells. This leads to the worm not being able to absorb sugar (glucose), which are essential for its survival. Therefore the energy stores of the worm are depleted, and this leads to its eventual death within several days.
It is used to treat Hydatid disease (echinococcosis) and infection of the nervous system caused by pork tapeworms (neurocysticercosis), also for Hookworm, Ascariasis, Whipworm and Strongyloidiasis.
Storage Keep container tightly closed in a cool, well-ventilated area.
MSDS Provide as per request after the order or contract is signed.
Synonyms: Albendazole suspension;[5-(PROPYLTHIO)-1H-BENZIMIDAZOL-2-YL]CARBAMIC ACID, METHYL ESTER;[5-(PROPYLTHIO)BENZIMIDAZOL-2-YL]CARBAMIC ACID METHYL ESTER;(5-PROPYLSULFANYL-1H-BENZOIMIDAZOL-2-YL)-CARBAMIC ACID METHYL ESTER;ALBAZINE;ALBEN;ALBENZA;AKOS NCG1-0064;(5-(Propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester;methyl [6-(propylsulfanyl)-1H-benzimidazol-2-yl]carbamate;
Molecular Structure: Albendazole 54965-21-8
Send your inquiry to Albendazole supplier

Enter between 20 to 3,000 characters,English only.

ChemNet  |   Product  |   Suppliers  |   Buy  |   Sell  |   News  |   REACH  |   Directory  |   CAS  |   Resource
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd.