Details for Vinyl chloride Vinyl acetate copolymer

Vinyl chloride Vinyl acetate copolymer
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
9003-22-9 |
| EC NO: |
|
| Molecular Formula: |
[-CH2CH(Cl)-]x[-CH2CH(O2CCH3)-]y |
| Molecular Weight: |
148.5889 |
| Specification: |
|
| InChI: |
InChI=1/C4H6O2.C2H3Cl/c1-3-6-4(2)5;1-2-3/h3H,1H2,2H3;2H,1H2 |
| Synonyms: |
Poly(Vinyl chloride-co-vinyl acetate);50me;a15;a15(polymer);a15s;aceticacid,vinylester,polymerwithchloroethylene; |
| Molecular Structure: |
 |
if you are sourcing Vinyl chloride Vinyl acetate copolymer from China ,just feel free to inquire