228573-90-8 Tropine-3-thiol
| Produkt-Name |
Tropine-3-thiol |
| Englischer Name |
Tropine-3-thiol;8-Methyl-8-azabicyclo[3.2.1]octane-3-thiol; 7-methyl-7-azabicyclo[2.2.1]heptane-2-thiol |
| Molekulare Formel |
C7H13NS |
| Molecular Weight |
143.25 |
| InChI |
InChI=1/C7H13NS/c1-8-5-2-3-6(8)7(9)4-5/h5-7,9H,2-4H2,1H3 |
| CAS Registry Number |
228573-90-8 |
| Molecular Structure |
|
| Dichte |
1.1g/cm3 |
| Siedepunkt |
193.3°C at 760 mmHg |
| Brechungsindex |
1.561 |
| Flammpunkt |
70.7°C |
| Dampfdruck |
0.468mmHg at 25°C |
|