76649-14-4 3-Octen-2-ol
| Produkt-Name |
3-Octen-2-ol |
| Englischer Name |
3-Octen-2-ol;FEMA No. 3602; oct-3-en-2-ol; (3E)-oct-3-en-2-ol |
| Molekulare Formel |
C8H16O |
| Molecular Weight |
128.212 |
| InChI |
InChI=1/C8H16O/c1-3-4-5-6-7-8(2)9/h6-9H,3-5H2,1-2H3/b7-6+ |
| CAS Registry Number |
76649-14-4 |
| EINECS |
278-508-9 |
| Molecular Structure |
|
| Dichte |
0.843g/cm3 |
| Siedepunkt |
178.8°C at 760 mmHg |
| Brechungsindex |
1.447 |
| Flammpunkt |
63.4°C |
| Dampfdruck |
0.291mmHg at 25°C |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|