105-54-4 Ethyl butyrate
| product Name |
Ethyl butyrate |
| CAS No |
105-54-4 |
| Synonyms |
Butyric acid ethyl ester; Ethylbutyrat; Ethyl butanoate; ETHYL BUTYRATE; ethyl butanoate; ethyl ester; butyric acid |
| Molecular Formula |
C6H12O2 |
| Molecular Weight |
116.1583 |
| InChI |
InChI=1/C6H12O2/c1-3-5-6(7)8-4-2/h3-5H2,1-2H3 |
| EINECS |
203-306-4 |
| Molecular Structure |
|
| Density |
0.886g/cm3 |
| Melting point |
-93.3℃ |
| Boiling point |
122.4°C at 760 mmHg |
| Refractive index |
1.397 |
| Flash point |
19.4°C |
| Water solubility |
practically insoluble |
| Vapour Pressur |
13.9mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R10:;
R36/37/38:;
|
| Safety Description |
S16:;
S26:;
S36:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Specifications |
99%min |
| Packing |
180kg/drum, 80drums/20'FCL or as your request |
| Description |
1.manufacturer of ethyl butyrate 2.CAS NO.105-54-4 3.through ISO9001:2008 Product Name Ethyl butyrate CAS No. 105-54-4 Chemical formula C6H12O2 Purity 98%, 99% Appearance Colorless to pale yellow liquid with banana-pineapple sweet odor Acid value ¡Ü1.0 Heavy metal(Pb) ¡Ü0.001% As value ¡Ü0.0002% Spec. gravity @ 25¡ãC 0.870-0.878 Melting point -93¡ãC Boiling point 120¡ãC Flashing point 25¡ãC Refractive index @ 20¡ãC 1.391-1.394 |
| Contact |
Ms. Pauline |
| Telephone |
+86-371-66777261;66760611 |
| Email |
sales@yibangchem.com |
| Address |
No.8 Xinglong Street, Erqi District, Zhengzhou, Henan, China |
| Specifications |
98% 99% |
| Contact |
Xia Jihai |
| Telephone |
+86-13605116558 |
| Email |
xsy@qihebiochem.com |
| Address |
No. 591 Feihe North Road, Mohekou Industrial Park,Huaishang District, Bengbu City, Anhui Province, China |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Dr.Wang HX;Mr.Zhang Yi |
| Telephone |
+86-510-87823598;87479185 |
| Email |
zhg@zhgchem.com |
| Address |
Yongning Road, Yixiang Economic Development Zone, Jiangsu Province, China. |
| Telephone |
0086-21-57448268 |
| Email |
smcsales@hi2000.com |
| Address |
No.428#Chuhua Branch Road, Fengxian District, Shanghai . |