CAS No: 105734-68-7, Chemical Name: 3-(5-chloro-1,2-benzothiazol-3-yl)-1,1-dimethylurea
the physical and chemical property of 105734-68-7, 3-(5-chloro-1,2-benzothiazol-3-yl)-1,1-dimethylurea is provided by ChemNet.com
ChemNet > CAS > 105734-68-7 3-(5-chloro-1,2-benzothiazol-3-yl)-1,1-dimethylurea
105734-68-7 3-(5-chloro-1,2-benzothiazol-3-yl)-1,1-dimethylurea
| product Name |
3-(5-chloro-1,2-benzothiazol-3-yl)-1,1-dimethylurea |
| Synonyms |
|
| Molecular Formula |
C10H10ClN3OS |
| Molecular Weight |
255.7239 |
| InChI |
InChI=1/C10H10ClN3OS/c1-14(2)10(15)12-9-7-5-6(11)3-4-8(7)16-13-9/h3-5H,1-2H3,(H,12,13,15) |
| CAS Registry Number |
105734-68-7 |
| Molecular Structure |
|
| Density |
1.46g/cm3 |
| Boiling point |
388.8°C at 760 mmHg |
| Refractive index |
1.705 |
| Flash point |
188.9°C |
| Vapour Pressur |
2.99E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
