1115-70-4 Metformin HCL
| product Name |
Metformin HCL |
| CAS No |
1115-70-4;15537-72-1 |
| Synonyms |
Metformin Hydrochloride; 3-(diaminomethylidene)-1,1-dimethylguanidine hydrochloride (1:1); 1,1-dimethylbiguanide hydrochloride |
| Molecular Formula |
C4H12ClN5 |
| Molecular Weight |
165.6246 |
| InChI |
InChI=1/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H |
| EINECS |
214-230-6 |
| Molecular Structure |
|
| Melting point |
223-226℃ |
| Boiling point |
224.1°C at 760 mmHg |
| Flash point |
89.3°C |
| Vapour Pressur |
0.0929mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36/38:;
|
| Safety Description |
S26:;
S36:;
|
|