1117-86-8 1,2-Octanediol
| product Name |
1,2-Octanediol |
| CAS No |
1117-86-8 |
| Synonyms |
1,2-Dihydroxyoctane; octane-1,2-diol; (2R)-octane-1,2-diol; (2S)-octane-1,2-diol; n-Octane-1,2-diol; octane-1; 1,2-Octyleneglycol; 1,2-Octylene glycol; 1,2-Octandiol; 1,2-0ctanediol; (R,S)-Octane-1,2-diol |
| Molecular Formula |
C8H18O2 |
| Molecular Weight |
146.2273 |
| InChI |
InChI=1/C8H18O2/c1-2-3-4-5-6-8(10)7-9/h8-10H,2-7H2,1H3/t8-/m0/s1 |
| EINECS |
214-254-7 |
| Molecular Structure |
|
| Density |
0.937g/cm3 |
| Melting point |
36-38℃ |
| Boiling point |
243°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
109.1°C |
| Water solubility |
3 g/L (20℃) |
| Vapour Pressur |
0.00559mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant;
|
| Risk Codes |
R36:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|