CAS No: 123332-35-4, Chemical Name: 2,3-diethyl-4,5-dimethoxynaphthalen-1-yl acetate
the physical and chemical property of 123332-35-4, 2,3-diethyl-4,5-dimethoxynaphthalen-1-yl acetate is provided by ChemNet.com
ChemNet > CAS > 123332-35-4 2,3-diethyl-4,5-dimethoxynaphthalen-1-yl acetate
123332-35-4 2,3-diethyl-4,5-dimethoxynaphthalen-1-yl acetate
| product Name |
2,3-diethyl-4,5-dimethoxynaphthalen-1-yl acetate |
| Synonyms |
1-naphthalenol, 2,3-diethyl-4,5-dimethoxy-, acetate |
| Molecular Formula |
C18H22O4 |
| Molecular Weight |
302.3649 |
| InChI |
InChI=1/C18H22O4/c1-6-12-13(7-2)18(21-5)16-14(17(12)22-11(3)19)9-8-10-15(16)20-4/h8-10H,6-7H2,1-5H3 |
| CAS Registry Number |
123332-35-4 |
| Molecular Structure |
|
| Density |
1.1g/cm3 |
| Boiling point |
413.7°C at 760 mmHg |
| Refractive index |
1.552 |
| Flash point |
180.4°C |
| Vapour Pressur |
4.71E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
