ChemNet > CAS > 127906-27-8 2-(3-Hydroxyphenylsulfanyl)-N,N-dimethylbenzylamine hydrogen maleate
127906-27-8 2-(3-Hydroxyphenylsulfanyl)-N,N-dimethylbenzylamine hydrogen maleate
| product Name |
2-(3-Hydroxyphenylsulfanyl)-N,N-dimethylbenzylamine hydrogen maleate |
| CAS No |
127906-27-8 |
| Synonyms |
Moxifetin hydrogen maleate; VUFB-15468; 3-[2-(Dimethylaminomethyl)phenylsulfanyl]phenol hydrogen maleate; 4-({2-[(dimethylamino)methyl]phenyl}sulfanyl)phenol (2E)-but-2-enedioate (salt) |
| Molecular Formula |
C19H21NO5S |
| Molecular Weight |
375.4387 |
| InChI |
InChI=1/C15H17NOS.C4H4O4/c1-16(2)11-12-5-3-4-6-15(12)18-14-9-7-13(17)8-10-14;5-3(6)1-2-4(7)8/h3-10,17H,11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| Molecular Structure |
|
| Boiling point |
380.1°C at 760 mmHg |
| Flash point |
183.7°C |
| Vapour Pressur |
2.56E-06mmHg at 25°C |
|